C17H26BrN3 — CID 87121392
1-(3-benzylimidazol-3-ium-1-yl)-N,N-diethylpropan-1-amine bromide (PubChem CID 87121392) has the molecular formula C17H26BrN3 and a molecular weight of 352.32 g/mol. Its IUPAC name is 1-(3-benzylimidazol-3-ium-1-yl)-N,N-diethylpropan-1-amine bromide.
| Compound Name | 1-(3-benzylimidazol-3-ium-1-yl)-N,N-diethylpropan-1-amine bromide |
|---|---|
| PubChem CID | 87121392 |
| Molecular Formula | C17H26BrN3 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1-(3-benzylimidazol-3-ium-1-yl)-N,N-diethylpropan-1-amine bromide |
| SMILES | CCC(N(CC)CC)n1cc[n+](Cc2ccccc2)c1.[Br-] |
| InChI | InChI=1S/C17H26N3.BrH/c1-4-17(19(5-2)6-3)20-13-12-18(15-20)14-16-10-8-7-9-11-16;/h7-13,15,17H,4-6,14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HOPCYFGJPCQQHU-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 12.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|