C18H31N4O3+ — CID 8712352
[2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium (PubChem CID 8712352) has the molecular formula C18H31N4O3+ and a molecular weight of 351.47 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8712352 |
| Molecular Formula | C18H31N4O3+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl]-[2-(dimethylamino)-2-oxoethyl]-methylazanium |
| SMILES | CN(C)C(=O)C[NH+](C)CC(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H30N4O3/c1-21(2)16(24)11-22(3)10-15(23)19-17(25)20-18-7-12-4-13(8-18)6-14(5-12)9-18/h12-14H,4-11H2,1-3H3,(H2,19,20,23,25)/p+1 |
| InChIKey | OVDMSFNRICCLPF-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |