C20H34N4O3 — CID 8767271
N-(1-adamantylcarbamoyl)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetamide (PubChem CID 8767271) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-(1-adamantylcarbamoyl)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetamide.
| Compound Name | N-(1-adamantylcarbamoyl)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetamide |
|---|---|
| PubChem CID | 8767271 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | N-(1-adamantylcarbamoyl)-2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]acetamide |
| SMILES | CN(CC(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H34N4O3/c1-19(2,3)22-17(26)12-24(4)11-16(25)21-18(27)23-20-8-13-5-14(9-20)7-15(6-13)10-20/h13-15H,5-12H2,1-4H3,(H,22,26)(H2,21,23,25,27) |
| InChIKey | CRJOYNUFVDKTHF-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |