C20H36N3O2+ — CID 8795996
[2-(1-adamantylamino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium (PubChem CID 8795996) has the molecular formula C20H36N3O2+ and a molecular weight of 350.53 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8795996 |
| Molecular Formula | C20H36N3O2+ |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
| SMILES | CC[NH+](CC(=O)NC(C)(C)C)CC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H35N3O2/c1-5-23(12-17(24)21-19(2,3)4)13-18(25)22-20-9-14-6-15(10-20)8-16(7-14)11-20/h14-16H,5-13H2,1-4H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | YTZMVRNJSFZTEX-UHFFFAOYSA-O |
| XLogP | 0.89 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |