C18H10O5 — CID 87124399
2,3,4-triformylanthracene-1-carboxylic acid (PubChem CID 87124399) has the molecular formula C18H10O5 and a molecular weight of 306.27 g/mol. Its IUPAC name is 2,3,4-triformylanthracene-1-carboxylic acid.
| Compound Name | 2,3,4-triformylanthracene-1-carboxylic acid |
|---|---|
| PubChem CID | 87124399 |
| Molecular Formula | C18H10O5 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2,3,4-triformylanthracene-1-carboxylic acid |
| SMILES | O=Cc1c(C=O)c(C(=O)O)c2cc3ccccc3cc2c1C=O |
| InChI | InChI=1S/C18H10O5/c19-7-14-12-5-10-3-1-2-4-11(10)6-13(12)17(18(22)23)16(9-21)15(14)8-20/h1-9H,(H,22,23) |
| InChIKey | VXEUOEYXUCFTTA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|