C12H22S2 — CID 87126664
(Z)-3-cyclohexylhex-3-ene-1,6-dithiol (PubChem CID 87126664) has the molecular formula C12H22S2 and a molecular weight of 230.44 g/mol. Its IUPAC name is (Z)-3-cyclohexylhex-3-ene-1,6-dithiol.
| Compound Name | (Z)-3-cyclohexylhex-3-ene-1,6-dithiol |
|---|---|
| PubChem CID | 87126664 |
| Molecular Formula | C12H22S2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (Z)-3-cyclohexylhex-3-ene-1,6-dithiol |
| SMILES | SCC/C=C(/CCS)C1CCCCC1 |
| InChI | InChI=1S/C12H22S2/c13-9-4-7-12(8-10-14)11-5-2-1-3-6-11/h7,11,13-14H,1-6,8-10H2/b12-7- |
| InChIKey | KZPVVDVHFVHANU-GHXNOFRVSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|