About [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane
[(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane (PubChem CID 89170399) has the molecular formula C13H21I
and a molecular weight of 304.21 g/mol. Its IUPAC name is [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane.
Molecular Properties
| Compound Name | [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane |
| PubChem CID | 89170399 |
| Molecular Formula | C13H21I |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane |
| SMILES | C=C(CC/C(I)=C\C)C1CCCCC1 |
| InChI | InChI=1S/C13H21I/c1-3-13(14)10-9-11(2)12-7-5-4-6-8-12/h3,12H,2,4-10H2,1H3/b13-3+ |
| InChIKey | AUIYVPDQXKWKDY-QLKAYGNNSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane?
The IUPAC name of [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane (CID 89170399) is [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane.
What is the SMILES notation for [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane?
The canonical SMILES for [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane is C=C(CC/C(I)=C\C)C1CCCCC1.
What is the InChIKey of [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane?
The InChIKey is AUIYVPDQXKWKDY-QLKAYGNNSA-N. The full InChI is InChI=1S/C13H21I/c1-3-13(14)10-9-11(2)12-7-5-4-6-8-12/h3,12H,2,4-10H2,1H3/b13-3+.
What are the key properties of [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane?
[(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane has a molecular weight of 304.21 g/mol, XLogP of 5.24, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(5E)-5-iodohepta-1,5-dien-2-yl]cyclohexane is sourced from PubChem (CID 89170399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).