C21H34O4 — CID 87129482
(2E)-5-methoxycarbonyl-4,6,10-trimethyl-2-pentylundeca-2,5,9-trienoic acid (PubChem CID 87129482) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is (2E)-5-methoxycarbonyl-4,6,10-trimethyl-2-pentylundeca-2,5,9-trienoic acid.
| Compound Name | (2E)-5-methoxycarbonyl-4,6,10-trimethyl-2-pentylundeca-2,5,9-trienoic acid |
|---|---|
| PubChem CID | 87129482 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | (2E)-5-methoxycarbonyl-4,6,10-trimethyl-2-pentylundeca-2,5,9-trienoic acid |
| SMILES | CCCCC/C(=C\C(C)C(C(=O)OC)=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C21H34O4/c1-7-8-9-13-18(20(22)23)14-17(5)19(21(24)25-6)16(4)12-10-11-15(2)3/h11,14,17H,7-10,12-13H2,1-6H3,(H,22,23)/b18-14+,19-16? |
| InChIKey | LWLPQQHTKKPGLK-VSGBNPLHSA-N |
| XLogP | 5.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|