C12H20O3 — CID 15935652
methyl (2E)-2-methoxy-3,7-dimethylocta-2,6-dienoate (PubChem CID 15935652) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is methyl (2E)-2-methoxy-3,7-dimethylocta-2,6-dienoate.
| Compound Name | methyl (2E)-2-methoxy-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 15935652 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | methyl (2E)-2-methoxy-3,7-dimethylocta-2,6-dienoate |
| SMILES | COC(=O)/C(OC)=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C12H20O3/c1-9(2)7-6-8-10(3)11(14-4)12(13)15-5/h7H,6,8H2,1-5H3/b11-10+ |
| InChIKey | VKLDNOICRURMPL-ZHACJKMWSA-N |
| XLogP | 2.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|