C21H36O4 — CID 87129481
(2E)-2-propylideneheptanoic acid;(2E)-2,3,7-trimethylocta-2,6-dienoic acid (PubChem CID 87129481) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is (2E)-2-propylideneheptanoic acid;(2E)-2,3,7-trimethylocta-2,6-dienoic acid.
| Compound Name | (2E)-2-propylideneheptanoic acid;(2E)-2,3,7-trimethylocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 87129481 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | (2E)-2-propylideneheptanoic acid;(2E)-2,3,7-trimethylocta-2,6-dienoic acid |
| SMILES | CC(C)=CCC/C(C)=C(\C)C(=O)O.CC/C=C(\CCCCC)C(=O)O |
| InChI | InChI=1S/C11H18O2.C10H18O2/c1-8(2)6-5-7-9(3)10(4)11(12)13;1-3-5-6-8-9(7-4-2)10(11)12/h6H,5,7H2,1-4H3,(H,12,13);7H,3-6,8H2,1-2H3,(H,11,12)/b10-9+;9-7+ |
| InChIKey | DQTKZWIQANVSBC-ZQROBYPSSA-N |
| XLogP | 6.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|