C28H54O4 — CID 87137204
12,14,14-trimethyl-9-(3,5,5-trimethylhexoxycarbonyl)pentadecanoic acid (PubChem CID 87137204) has the molecular formula C28H54O4 and a molecular weight of 454.74 g/mol. Its IUPAC name is 12,14,14-trimethyl-9-(3,5,5-trimethylhexoxycarbonyl)pentadecanoic acid.
| Compound Name | 12,14,14-trimethyl-9-(3,5,5-trimethylhexoxycarbonyl)pentadecanoic acid |
|---|---|
| PubChem CID | 87137204 |
| Molecular Formula | C28H54O4 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.40 |
| IUPAC Name | 12,14,14-trimethyl-9-(3,5,5-trimethylhexoxycarbonyl)pentadecanoic acid |
| SMILES | CC(CCOC(=O)C(CCCCCCCC(=O)O)CCC(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C28H54O4/c1-22(20-27(3,4)5)16-17-24(14-12-10-9-11-13-15-25(29)30)26(31)32-19-18-23(2)21-28(6,7)8/h22-24H,9-21H2,1-8H3,(H,29,30) |
| InChIKey | CSFLBJIEBAVEIX-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|