C44H45P3 — CID 87138739
[2,2-bis[diphenyl(phosphanyl)methyl]-3,3-dimethyl-1,1-diphenylbutyl]phosphane (PubChem CID 87138739) has the molecular formula C44H45P3 and a molecular weight of 666.77 g/mol. Its IUPAC name is [2,2-bis[diphenyl(phosphanyl)methyl]-3,3-dimethyl-1,1-diphenylbutyl]phosphane.
| Compound Name | [2,2-bis[diphenyl(phosphanyl)methyl]-3,3-dimethyl-1,1-diphenylbutyl]phosphane |
|---|---|
| PubChem CID | 87138739 |
| Molecular Formula | C44H45P3 |
| Molecular Weight | 666.77 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | [2,2-bis[diphenyl(phosphanyl)methyl]-3,3-dimethyl-1,1-diphenylbutyl]phosphane |
| SMILES | CC(C)(C)C(C(P)(c1ccccc1)c1ccccc1)(C(P)(c1ccccc1)c1ccccc1)C(P)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H45P3/c1-40(2,3)44(41(45,34-22-10-4-11-23-34)35-24-12-5-13-25-35,42(46,36-26-14-6-15-27-36)37-28-16-7-17-29-37)43(47,38-30-18-8-19-31-38)39-32-20-9-21-33-39/h4-33H,45-47H2,1-3H3 |
| InChIKey | FLNUNBCQWNZPAN-UHFFFAOYSA-N |
| XLogP | 11.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.77 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|