C16H14N2O4S — CID 87139682
5-carbamoyl-1,2-dimethylacridine-4-sulfonic acid (PubChem CID 87139682) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is 5-carbamoyl-1,2-dimethylacridine-4-sulfonic acid.
| Compound Name | 5-carbamoyl-1,2-dimethylacridine-4-sulfonic acid |
|---|---|
| PubChem CID | 87139682 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 5-carbamoyl-1,2-dimethylacridine-4-sulfonic acid |
| SMILES | Cc1cc(S(=O)(=O)O)c2nc3c(C(N)=O)cccc3cc2c1C |
| InChI | InChI=1S/C16H14N2O4S/c1-8-6-13(23(20,21)22)15-12(9(8)2)7-10-4-3-5-11(16(17)19)14(10)18-15/h3-7H,1-2H3,(H2,17,19)(H,20,21,22) |
| InChIKey | QJZSKEQUMHYDCZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|