C25H29F3N4O7S — CID 87142784
tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate (PubChem CID 87142784) has the molecular formula C25H29F3N4O7S and a molecular weight of 586.59 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87142784 |
| Molecular Formula | C25H29F3N4O7S |
| Molecular Weight | 586.59 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(3-oxomorpholin-4-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](S(=O)(=O)c2ccc(N3CCOCC3=O)cc2C(F)(F)F)C[C@H]1C(=O)N(C#N)C1CC1 |
| InChI | InChI=1S/C25H29F3N4O7S/c1-24(2,3)39-23(35)31-12-17(11-19(31)22(34)32(14-29)15-4-5-15)40(36,37)20-7-6-16(10-18(20)25(26,27)28)30-8-9-38-13-21(30)33/h6-7,10,15,17,19H,4-5,8-9,11-13H2,1-3H3/t17-,19+/m1/s1 |
| InChIKey | RSGORDGFIPFQJJ-MJGOQNOKSA-N |
| XLogP | 2.69 |
| TPSA | 137.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|