C24H27F3N4O7S — CID 87142937
tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(2-oxo-1,3-oxazolidin-3-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate (PubChem CID 87142937) has the molecular formula C24H27F3N4O7S and a molecular weight of 572.56 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(2-oxo-1,3-oxazolidin-3-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(2-oxo-1,3-oxazolidin-3-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87142937 |
| Molecular Formula | C24H27F3N4O7S |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-[4-(2-oxo-1,3-oxazolidin-3-yl)-2-(trifluoromethyl)phenyl]sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](S(=O)(=O)c2ccc(N3CCOC3=O)cc2C(F)(F)F)C[C@H]1C(=O)N(C#N)C1CC1 |
| InChI | InChI=1S/C24H27F3N4O7S/c1-23(2,3)38-22(34)30-12-16(11-18(30)20(32)31(13-28)14-4-5-14)39(35,36)19-7-6-15(10-17(19)24(25,26)27)29-8-9-37-21(29)33/h6-7,10,14,16,18H,4-5,8-9,11-12H2,1-3H3/t16-,18+/m1/s1 |
| InChIKey | KIDHNGJONOIGJA-AEFFLSMTSA-N |
| XLogP | 3.29 |
| TPSA | 137.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|