C21H26ClN3O5S — CID 87142975
tert-butyl (2S,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-[cyano(cyclopropyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 87142975) has the molecular formula C21H26ClN3O5S and a molecular weight of 467.98 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-[cyano(cyclopropyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-[cyano(cyclopropyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87142975 |
| Molecular Formula | C21H26ClN3O5S |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | tert-butyl (2S,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-[cyano(cyclopropyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)[C@@H]1C[C@@H](C(=O)N(C#N)C2CC2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H26ClN3O5S/c1-13-9-14(22)5-8-18(13)31(28,29)16-10-17(19(26)25(12-23)15-6-7-15)24(11-16)20(27)30-21(2,3)4/h5,8-9,15-17H,6-7,10-11H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | LJZJJJKHSGRRNB-SJORKVTESA-N |
| XLogP | 3.27 |
| TPSA | 107.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|