C23H27N5O5S — CID 87142860
tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-(4-imidazol-1-ylphenyl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 87142860) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-(4-imidazol-1-ylphenyl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-(4-imidazol-1-ylphenyl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 87142860 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | tert-butyl (2S,4R)-2-[cyano(cyclopropyl)carbamoyl]-4-(4-imidazol-1-ylphenyl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](S(=O)(=O)c2ccc(-n3ccnc3)cc2)C[C@H]1C(=O)N(C#N)C1CC1 |
| InChI | InChI=1S/C23H27N5O5S/c1-23(2,3)33-22(30)27-13-19(12-20(27)21(29)28(14-24)17-4-5-17)34(31,32)18-8-6-16(7-9-18)26-11-10-25-15-26/h6-11,15,17,19-20H,4-5,12-13H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | UFTSNGPQLJTQDM-UXHICEINSA-N |
| XLogP | 2.50 |
| TPSA | 125.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|