C6H9ClS — CID 87152904
(1E,3Z)-1-chloro-4-methylsulfanylpenta-1,3-diene (PubChem CID 87152904) has the molecular formula C6H9ClS and a molecular weight of 148.66 g/mol. Its IUPAC name is (1E,3Z)-1-chloro-4-methylsulfanylpenta-1,3-diene.
| Compound Name | (1E,3Z)-1-chloro-4-methylsulfanylpenta-1,3-diene |
|---|---|
| PubChem CID | 87152904 |
| Molecular Formula | C6H9ClS |
| Molecular Weight | 148.66 g/mol |
| Exact Mass | 148.01 |
| IUPAC Name | (1E,3Z)-1-chloro-4-methylsulfanylpenta-1,3-diene |
| SMILES | CS/C(C)=C\C=C\Cl |
| InChI | InChI=1S/C6H9ClS/c1-6(8-2)4-3-5-7/h3-5H,1-2H3/b5-3+,6-4- |
| InChIKey | IAOFPZSITZELBD-UZNMPDEFSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.66 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|