About 1-fluoroethenyl phenyl sulfate
1-fluoroethenyl phenyl sulfate (PubChem CID 87154768) has the molecular formula C8H7FO4S
and a molecular weight of 218.20 g/mol. Its IUPAC name is 1-fluoroethenyl phenyl sulfate.
Molecular Properties
| Compound Name | 1-fluoroethenyl phenyl sulfate |
| PubChem CID | 87154768 |
| Molecular Formula | C8H7FO4S |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 1-fluoroethenyl phenyl sulfate |
| SMILES | C=C(F)OS(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H7FO4S/c1-7(9)12-14(10,11)13-8-5-3-2-4-6-8/h2-6H,1H2 |
| InChIKey | DSSZKZKWPHVAFB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroethenyl phenyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroethenyl phenyl sulfate?
The IUPAC name of 1-fluoroethenyl phenyl sulfate (CID 87154768) is 1-fluoroethenyl phenyl sulfate.
What is the SMILES notation for 1-fluoroethenyl phenyl sulfate?
The canonical SMILES for 1-fluoroethenyl phenyl sulfate is C=C(F)OS(=O)(=O)Oc1ccccc1.
What is the InChIKey of 1-fluoroethenyl phenyl sulfate?
The InChIKey is DSSZKZKWPHVAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO4S/c1-7(9)12-14(10,11)13-8-5-3-2-4-6-8/h2-6H,1H2.
What are the key properties of 1-fluoroethenyl phenyl sulfate?
1-fluoroethenyl phenyl sulfate has a molecular weight of 218.20 g/mol, XLogP of 1.77, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroethenyl phenyl sulfate is sourced from PubChem (CID 87154768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).