About S-methylsulfanyl 3-methylbenzenecarbothioate
S-methylsulfanyl 3-methylbenzenecarbothioate (PubChem CID 87155089) has the molecular formula C9H10OS2
and a molecular weight of 198.31 g/mol. Its IUPAC name is S-methylsulfanyl 3-methylbenzenecarbothioate.
Molecular Properties
| Compound Name | S-methylsulfanyl 3-methylbenzenecarbothioate |
| PubChem CID | 87155089 |
| Molecular Formula | C9H10OS2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | S-methylsulfanyl 3-methylbenzenecarbothioate |
| SMILES | CSSC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C9H10OS2/c1-7-4-3-5-8(6-7)9(10)12-11-2/h3-6H,1-2H3 |
| InChIKey | ZQOWULAIYJMOHG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methylsulfanyl 3-methylbenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methylsulfanyl 3-methylbenzenecarbothioate?
The IUPAC name of S-methylsulfanyl 3-methylbenzenecarbothioate (CID 87155089) is S-methylsulfanyl 3-methylbenzenecarbothioate.
What is the SMILES notation for S-methylsulfanyl 3-methylbenzenecarbothioate?
The canonical SMILES for S-methylsulfanyl 3-methylbenzenecarbothioate is CSSC(=O)c1cccc(C)c1.
What is the InChIKey of S-methylsulfanyl 3-methylbenzenecarbothioate?
The InChIKey is ZQOWULAIYJMOHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10OS2/c1-7-4-3-5-8(6-7)9(10)12-11-2/h3-6H,1-2H3.
What are the key properties of S-methylsulfanyl 3-methylbenzenecarbothioate?
S-methylsulfanyl 3-methylbenzenecarbothioate has a molecular weight of 198.31 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-methylsulfanyl 3-methylbenzenecarbothioate is sourced from PubChem (CID 87155089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).