C11H9N3O3S — CID 727939
S-(3,5-dioxo-2H-1,2,4-triazin-6-yl) 3-methylbenzenecarbothioate (PubChem CID 727939) has the molecular formula C11H9N3O3S and a molecular weight of 263.28 g/mol. Its IUPAC name is S-(3,5-dioxo-2H-1,2,4-triazin-6-yl) 3-methylbenzenecarbothioate.
| Compound Name | S-(3,5-dioxo-2H-1,2,4-triazin-6-yl) 3-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 727939 |
| Molecular Formula | C11H9N3O3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | S-(3,5-dioxo-2H-1,2,4-triazin-6-yl) 3-methylbenzenecarbothioate |
| SMILES | Cc1cccc(C(=O)Sc2n[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C11H9N3O3S/c1-6-3-2-4-7(5-6)10(16)18-9-8(15)12-11(17)14-13-9/h2-5H,1H3,(H2,12,14,15,17) |
| InChIKey | USVLLINCKGPUMB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|