C15H21NO3 — CID 87161685
(2R,3S)-3-(nitromethyl)-5-phenyl-2-propylpentanal (PubChem CID 87161685) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (2R,3S)-3-(nitromethyl)-5-phenyl-2-propylpentanal.
| Compound Name | (2R,3S)-3-(nitromethyl)-5-phenyl-2-propylpentanal |
|---|---|
| PubChem CID | 87161685 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2R,3S)-3-(nitromethyl)-5-phenyl-2-propylpentanal |
| SMILES | CCC[C@@H](C=O)[C@H](CCc1ccccc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C15H21NO3/c1-2-6-15(12-17)14(11-16(18)19)10-9-13-7-4-3-5-8-13/h3-5,7-8,12,14-15H,2,6,9-11H2,1H3/t14-,15+/m1/s1 |
| InChIKey | SSWSLMGCBGKCMM-CABCVRRESA-N |
| XLogP | 3.13 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|