C10H9N3 — CID 87163350
cyclohept-3-ene-1,2,4-tricarbonitrile (PubChem CID 87163350) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is cyclohept-3-ene-1,2,4-tricarbonitrile.
| Compound Name | cyclohept-3-ene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 87163350 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | cyclohept-3-ene-1,2,4-tricarbonitrile |
| SMILES | N#CC1=CC(C#N)C(C#N)CCC1 |
| InChI | InChI=1S/C10H9N3/c11-5-8-2-1-3-9(6-12)10(4-8)7-13/h4,9-10H,1-3H2 |
| InChIKey | DBNBUUJKQRBMOJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |