C16H27NO3 — CID 87163900
(3Z,6Z,9Z)-N,N-bis(2-hydroxyethyl)dodeca-3,6,9-trienamide (PubChem CID 87163900) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (3Z,6Z,9Z)-N,N-bis(2-hydroxyethyl)dodeca-3,6,9-trienamide.
| Compound Name | (3Z,6Z,9Z)-N,N-bis(2-hydroxyethyl)dodeca-3,6,9-trienamide |
|---|---|
| PubChem CID | 87163900 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (3Z,6Z,9Z)-N,N-bis(2-hydroxyethyl)dodeca-3,6,9-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CC(=O)N(CCO)CCO |
| InChI | InChI=1S/C16H27NO3/c1-2-3-4-5-6-7-8-9-10-11-16(20)17(12-14-18)13-15-19/h3-4,6-7,9-10,18-19H,2,5,8,11-15H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | KWUOGIDTXVSSAN-PDBXOOCHSA-N |
| XLogP | 2.05 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|