C11H21NO3 — CID 59696146
(Z)-N,N-bis(2-hydroxyethyl)hept-3-enamide (PubChem CID 59696146) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (Z)-N,N-bis(2-hydroxyethyl)hept-3-enamide.
| Compound Name | (Z)-N,N-bis(2-hydroxyethyl)hept-3-enamide |
|---|---|
| PubChem CID | 59696146 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (Z)-N,N-bis(2-hydroxyethyl)hept-3-enamide |
| SMILES | CCC/C=C\CC(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H21NO3/c1-2-3-4-5-6-11(15)12(7-9-13)8-10-14/h4-5,13-14H,2-3,6-10H2,1H3/b5-4- |
| InChIKey | LJYWDBIKGVPNIS-PLNGDYQASA-N |
| XLogP | 0.55 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|