C29H26N4O4 — CID 87166199
(5R)-3-[(1S,2R)-1-(6-ethynyl-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(2-hydroxyethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 87166199) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is (5R)-3-[(1S,2R)-1-(6-ethynyl-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(2-hydroxyethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(1S,2R)-1-(6-ethynyl-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(2-hydroxyethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87166199 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | (5R)-3-[(1S,2R)-1-(6-ethynyl-1H-benzimidazol-2-yl)-2-phenylpropyl]-5-[4-(2-hydroxyethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | C#Cc1ccc2nc([C@H]([C@H](C)c3ccccc3)N3C(=O)N[C@H](c4ccc(OCCO)cc4)C3=O)[nH]c2c1 |
| InChI | InChI=1S/C29H26N4O4/c1-3-19-9-14-23-24(17-19)31-27(30-23)26(18(2)20-7-5-4-6-8-20)33-28(35)25(32-29(33)36)21-10-12-22(13-11-21)37-16-15-34/h1,4-14,17-18,25-26,34H,15-16H2,2H3,(H,30,31)(H,32,36)/t18-,25-,26+/m1/s1 |
| InChIKey | HPANRIOFRGTCGN-IHMJZKOGSA-N |
| XLogP | 4.05 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|