About 2-ethylhexanoate;tris(2-ethylhexyl)azanium
2-ethylhexanoate;tris(2-ethylhexyl)azanium (PubChem CID 87169314) has the molecular formula C32H67NO2
and a molecular weight of 497.89 g/mol. Its IUPAC name is 2-ethylhexanoate;tris(2-ethylhexyl)azanium.
Molecular Properties
| Compound Name | 2-ethylhexanoate;tris(2-ethylhexyl)azanium |
| PubChem CID | 87169314 |
| Molecular Formula | C32H67NO2 |
| Molecular Weight | 497.89 g/mol |
| Exact Mass | 497.52 |
| IUPAC Name | 2-ethylhexanoate;tris(2-ethylhexyl)azanium |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C[NH+](CC(CC)CCCC)CC(CC)CCCC |
| InChI | InChI=1S/C24H51N.C8H16O2/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3;1-3-5-6-7(4-2)8(9)10/h22-24H,7-21H2,1-6H3;7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | QDXGQCOATVHKMM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 497.89 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexanoate;tris(2-ethylhexyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoate;tris(2-ethylhexyl)azanium?
The IUPAC name of 2-ethylhexanoate;tris(2-ethylhexyl)azanium (CID 87169314) is 2-ethylhexanoate;tris(2-ethylhexyl)azanium.
What is the SMILES notation for 2-ethylhexanoate;tris(2-ethylhexyl)azanium?
The canonical SMILES for 2-ethylhexanoate;tris(2-ethylhexyl)azanium is CCCCC(CC)C(=O)[O-].CCCCC(CC)C[NH+](CC(CC)CCCC)CC(CC)CCCC.
What is the InChIKey of 2-ethylhexanoate;tris(2-ethylhexyl)azanium?
The InChIKey is QDXGQCOATVHKMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H51N.C8H16O2/c1-7-13-16-22(10-4)19-25(20-23(11-5)17-14-8-2)21-24(12-6)18-15-9-3;1-3-5-6-7(4-2)8(9)10/h22-24H,7-21H2,1-6H3;7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of 2-ethylhexanoate;tris(2-ethylhexyl)azanium?
2-ethylhexanoate;tris(2-ethylhexyl)azanium has a molecular weight of 497.89 g/mol, XLogP of 7.47, 23 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoate;tris(2-ethylhexyl)azanium is sourced from PubChem (CID 87169314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).