C16H32N2O3S2 — CID 87174347
N-[3-(2-hydroxyhexylsulfanyl)-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]-3-methylbutanamide (PubChem CID 87174347) has the molecular formula C16H32N2O3S2 and a molecular weight of 364.58 g/mol. Its IUPAC name is N-[3-(2-hydroxyhexylsulfanyl)-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]-3-methylbutanamide.
| Compound Name | N-[3-(2-hydroxyhexylsulfanyl)-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 87174347 |
| Molecular Formula | C16H32N2O3S2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-[3-(2-hydroxyhexylsulfanyl)-1-oxo-1-(2-sulfanylethylamino)propan-2-yl]-3-methylbutanamide |
| SMILES | CCCCC(O)CSCC(NC(=O)CC(C)C)C(=O)NCCS |
| InChI | InChI=1S/C16H32N2O3S2/c1-4-5-6-13(19)10-23-11-14(16(21)17-7-8-22)18-15(20)9-12(2)3/h12-14,19,22H,4-11H2,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | JPGGZSQIHXURMC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|