C11H31NO2Si3 — CID 87174858
1-[dimethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 87174858) has the molecular formula C11H31NO2Si3 and a molecular weight of 293.63 g/mol. Its IUPAC name is 1-[dimethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)ethanamine.
| Compound Name | 1-[dimethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 87174858 |
| Molecular Formula | C11H31NO2Si3 |
| Molecular Weight | 293.63 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 1-[dimethoxy(methyl)silyl]-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | CO[Si](C)(OC)C(C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H31NO2Si3/c1-11(17(10,13-2)14-3)12(15(4,5)6)16(7,8)9/h11H,1-10H3 |
| InChIKey | ZNXWMXROGJWGON-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|