C20H27ClN2OS2 — CID 87179395
N-[5-tert-butyl-3-(2-methylpropyl)-1,3-thiazol-2-ylidene]-5-chloro-2-ethoxybenzenecarbothioamide (PubChem CID 87179395) has the molecular formula C20H27ClN2OS2 and a molecular weight of 411.04 g/mol. Its IUPAC name is N-[5-tert-butyl-3-(2-methylpropyl)-1,3-thiazol-2-ylidene]-5-chloro-2-ethoxybenzenecarbothioamide.
| Compound Name | N-[5-tert-butyl-3-(2-methylpropyl)-1,3-thiazol-2-ylidene]-5-chloro-2-ethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 87179395 |
| Molecular Formula | C20H27ClN2OS2 |
| Molecular Weight | 411.04 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[5-tert-butyl-3-(2-methylpropyl)-1,3-thiazol-2-ylidene]-5-chloro-2-ethoxybenzenecarbothioamide |
| SMILES | CCOc1ccc(Cl)cc1C(=S)/N=c1/sc(C(C)(C)C)cn1CC(C)C |
| InChI | InChI=1S/C20H27ClN2OS2/c1-7-24-16-9-8-14(21)10-15(16)18(25)22-19-23(11-13(2)3)12-17(26-19)20(4,5)6/h8-10,12-13H,7,11H2,1-6H3/b22-19+ |
| InChIKey | XZUHASZVCUTYTH-ZBJSNUHESA-N |
| XLogP | 5.83 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.04 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|