C10H26N2O10S2 — CID 87180901
2-hydroxy-1-[4-(2-hydroxy-1-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid;dihydrate (PubChem CID 87180901) has the molecular formula C10H26N2O10S2 and a molecular weight of 398.46 g/mol. Its IUPAC name is 2-hydroxy-1-[4-(2-hydroxy-1-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid;dihydrate.
| Compound Name | 2-hydroxy-1-[4-(2-hydroxy-1-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid;dihydrate |
|---|---|
| PubChem CID | 87180901 |
| Molecular Formula | C10H26N2O10S2 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-hydroxy-1-[4-(2-hydroxy-1-sulfopropyl)piperazin-1-yl]propane-1-sulfonic acid;dihydrate |
| SMILES | CC(O)C(N1CCN(C(C(C)O)S(=O)(=O)O)CC1)S(=O)(=O)O.O.O |
| InChI | InChI=1S/C10H22N2O8S2.2H2O/c1-7(13)9(21(15,16)17)11-3-5-12(6-4-11)10(8(2)14)22(18,19)20;;/h7-10,13-14H,3-6H2,1-2H3,(H,15,16,17)(H,18,19,20);2*1H2 |
| InChIKey | UVEYEXGGRVYSBT-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 218.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|