C24H44O4 — CID 87184355
acetyl (Z,12R)-2-butyl-12-hydroxyoctadec-9-enoate (PubChem CID 87184355) has the molecular formula C24H44O4 and a molecular weight of 396.61 g/mol. Its IUPAC name is acetyl (Z,12R)-2-butyl-12-hydroxyoctadec-9-enoate.
| Compound Name | acetyl (Z,12R)-2-butyl-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 87184355 |
| Molecular Formula | C24H44O4 |
| Molecular Weight | 396.61 g/mol |
| Exact Mass | 396.32 |
| IUPAC Name | acetyl (Z,12R)-2-butyl-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCC(CCCC)C(=O)OC(C)=O |
| InChI | InChI=1S/C24H44O4/c1-4-6-8-15-19-23(26)20-16-13-11-9-10-12-14-18-22(17-7-5-2)24(27)28-21(3)25/h13,16,22-23,26H,4-12,14-15,17-20H2,1-3H3/b16-13-/t22?,23-/m1/s1 |
| InChIKey | ZUAIIUFOXZIVNA-FXMZGXLRSA-N |
| XLogP | 6.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|