C23H24BrO2P — CID 87185959
(4-carboxy-3,3,4,4-tetradeuteriobutyl)-triphenylphosphanium bromide (PubChem CID 87185959) has the molecular formula C23H24BrO2P and a molecular weight of 447.35 g/mol. Its IUPAC name is (4-carboxy-3,3,4,4-tetradeuteriobutyl)-triphenylphosphanium bromide.
| Compound Name | (4-carboxy-3,3,4,4-tetradeuteriobutyl)-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 87185959 |
| Molecular Formula | C23H24BrO2P |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (4-carboxy-3,3,4,4-tetradeuteriobutyl)-triphenylphosphanium bromide |
| SMILES | [2H]C([2H])(CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C([2H])([2H])C(=O)O.[Br-] |
| InChI | InChI=1S/C23H23O2P.BrH/c24-23(25)18-10-11-19-26(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22;/h1-9,12-17H,10-11,18-19H2;1H/i10D2,18D2; |
| InChIKey | MLOSJPZSZWUDSK-VYPPCMRJSA-N |
| XLogP | 1.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|