About diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate
diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate (PubChem CID 87196499) has the molecular formula C18H10O7
and a molecular weight of 338.27 g/mol. Its IUPAC name is diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate.
Molecular Properties
| Compound Name | diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate |
| PubChem CID | 87196499 |
| Molecular Formula | C18H10O7 |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate |
| SMILES | O=C1OC(=O)C1=C(C(=O)Oc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H10O7/c19-15(23-11-7-3-1-4-8-11)13(14-17(21)25-18(14)22)16(20)24-12-9-5-2-6-10-12/h1-10H |
| InChIKey | JNXIKBUDTCBALE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate?
The IUPAC name of diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate (CID 87196499) is diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate.
What is the SMILES notation for diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate?
The canonical SMILES for diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate is O=C1OC(=O)C1=C(C(=O)Oc1ccccc1)C(=O)Oc1ccccc1.
What is the InChIKey of diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate?
The InChIKey is JNXIKBUDTCBALE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10O7/c19-15(23-11-7-3-1-4-8-11)13(14-17(21)25-18(14)22)16(20)24-12-9-5-2-6-10-12/h1-10H.
What are the key properties of diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate?
diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate has a molecular weight of 338.27 g/mol, XLogP of 1.58, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl 2-(2,4-dioxooxetan-3-ylidene)propanedioate is sourced from PubChem (CID 87196499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).