C28H28F6N2O5 — CID 87198278
benzyl N-amino-N-[3-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]phenyl]carbamate (PubChem CID 87198278) has the molecular formula C28H28F6N2O5 and a molecular weight of 586.53 g/mol. Its IUPAC name is benzyl N-amino-N-[3-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]phenyl]carbamate.
| Compound Name | benzyl N-amino-N-[3-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 87198278 |
| Molecular Formula | C28H28F6N2O5 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | benzyl N-amino-N-[3-[4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylphenoxy]phenyl]carbamate |
| SMILES | CCCc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(N(N)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H28F6N2O5/c1-3-8-20-15-21(26(27(29,30)31,28(32,33)34)40-18-38-2)13-14-24(20)41-23-12-7-11-22(16-23)36(35)25(37)39-17-19-9-5-4-6-10-19/h4-7,9-16H,3,8,17-18,35H2,1-2H3 |
| InChIKey | JTRKOVHCHGZKLQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|