C15H15BO5P — CID 87204341
CID 87204341 (PubChem CID 87204341) has the molecular formula C15H15BO5P and a molecular weight of 317.07 g/mol.
| Compound Name | CID 87204341 |
|---|---|
| PubChem CID | 87204341 |
| Molecular Formula | C15H15BO5P |
| Molecular Weight | 317.07 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | — |
| SMILES | COP(=O)(O)CC1O[B]c2cc(Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C15H15BO5P/c1-19-22(17,18)10-15-13-8-7-12(9-14(13)16-21-15)20-11-5-3-2-4-6-11/h2-9,15H,10H2,1H3,(H,17,18) |
| InChIKey | GLKBGTUCXJFIHT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.07 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|