C22H34N4O4 — CID 87209520
tert-butyl (2S)-2-[formyloxy-(4-phenylpiperazin-1-yl)methyl]-4-methylpiperazine-1-carboxylate (PubChem CID 87209520) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is tert-butyl (2S)-2-[formyloxy-(4-phenylpiperazin-1-yl)methyl]-4-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[formyloxy-(4-phenylpiperazin-1-yl)methyl]-4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 87209520 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | tert-butyl (2S)-2-[formyloxy-(4-phenylpiperazin-1-yl)methyl]-4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OC(C)(C)C)[C@H](C(OC=O)N2CCN(c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C22H34N4O4/c1-22(2,3)30-21(28)26-15-10-23(4)16-19(26)20(29-17-27)25-13-11-24(12-14-25)18-8-6-5-7-9-18/h5-9,17,19-20H,10-16H2,1-4H3/t19-,20?/m0/s1 |
| InChIKey | ZNEPPHNWHJJSTO-XJDOXCRVSA-N |
| XLogP | 1.86 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|