C21H30FN3O5 — CID 87209521
tert-butyl (3R)-3-[[4-(4-fluorophenyl)piperazin-1-yl]-formyloxymethyl]morpholine-4-carboxylate (PubChem CID 87209521) has the molecular formula C21H30FN3O5 and a molecular weight of 423.49 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[4-(4-fluorophenyl)piperazin-1-yl]-formyloxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[4-(4-fluorophenyl)piperazin-1-yl]-formyloxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 87209521 |
| Molecular Formula | C21H30FN3O5 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | tert-butyl (3R)-3-[[4-(4-fluorophenyl)piperazin-1-yl]-formyloxymethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@@H]1C(OC=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H30FN3O5/c1-21(2,3)30-20(27)25-12-13-28-14-18(25)19(29-15-26)24-10-8-23(9-11-24)17-6-4-16(22)5-7-17/h4-7,15,18-19H,8-14H2,1-3H3/t18-,19?/m1/s1 |
| InChIKey | LRXDWIMHOFGPCN-MRTLOADZSA-N |
| XLogP | 2.08 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|