C26H39NO8 — CID 87212949
[4-[(2S)-2-(ethylamino)-3-methoxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate;oxiran-2-one (PubChem CID 87212949) has the molecular formula C26H39NO8 and a molecular weight of 493.60 g/mol. Its IUPAC name is [4-[(2S)-2-(ethylamino)-3-methoxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate;oxiran-2-one.
| Compound Name | [4-[(2S)-2-(ethylamino)-3-methoxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate;oxiran-2-one |
|---|---|
| PubChem CID | 87212949 |
| Molecular Formula | C26H39NO8 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [4-[(2S)-2-(ethylamino)-3-methoxy-3-oxopropyl]-2-(2-methylpentanoyloxy)phenyl] 2-methylpentanoate;oxiran-2-one |
| SMILES | CCCC(C)C(=O)Oc1ccc(C[C@H](NCC)C(=O)OC)cc1OC(=O)C(C)CCC.O=C1CO1 |
| InChI | InChI=1S/C24H37NO6.C2H2O2/c1-7-10-16(4)22(26)30-20-13-12-18(14-19(25-9-3)24(28)29-6)15-21(20)31-23(27)17(5)11-8-2;3-2-1-4-2/h12-13,15-17,19,25H,7-11,14H2,1-6H3;1H2/t16?,17?,19-;/m0./s1 |
| InChIKey | FDGMYAMUKICGFJ-HBUHALJHSA-N |
| XLogP | 3.61 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|