About CID 87214020
CID 87214020 (PubChem CID 87214020) has the molecular formula C5H9Cl3OSi
and a molecular weight of 219.57 g/mol.
Molecular Properties
| Compound Name | CID 87214020 |
| PubChem CID | 87214020 |
| Molecular Formula | C5H9Cl3OSi |
| Molecular Weight | 219.57 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | — |
| SMILES | ClCCC[Si]OCC(Cl)Cl |
| InChI | InChI=1S/C5H9Cl3OSi/c6-2-1-3-10-9-4-5(7)8/h5H,1-4H2 |
| InChIKey | ACHRCKORRHVLHL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87214020 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87214020?
The IUPAC name of CID 87214020 (CID 87214020) is not available.
What is the SMILES notation for CID 87214020?
The canonical SMILES for CID 87214020 is ClCCC[Si]OCC(Cl)Cl.
What is the InChIKey of CID 87214020?
The InChIKey is ACHRCKORRHVLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Cl3OSi/c6-2-1-3-10-9-4-5(7)8/h5H,1-4H2.
What are the key properties of CID 87214020?
CID 87214020 has a molecular weight of 219.57 g/mol, XLogP of 2.47, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87214020 is sourced from PubChem (CID 87214020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).