C13H33N3O3Si — CID 87217216
1-N'-[1-(1-triethoxysilylpropylamino)ethyl]ethane-1,1-diamine (PubChem CID 87217216) has the molecular formula C13H33N3O3Si and a molecular weight of 307.51 g/mol. Its IUPAC name is 1-N'-[1-(1-triethoxysilylpropylamino)ethyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[1-(1-triethoxysilylpropylamino)ethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 87217216 |
| Molecular Formula | C13H33N3O3Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 1-N'-[1-(1-triethoxysilylpropylamino)ethyl]ethane-1,1-diamine |
| SMILES | CCO[Si](OCC)(OCC)C(CC)NC(C)NC(C)N |
| InChI | InChI=1S/C13H33N3O3Si/c1-7-13(16-12(6)15-11(5)14)20(17-8-2,18-9-3)19-10-4/h11-13,15-16H,7-10,14H2,1-6H3 |
| InChIKey | XQWGFOSINRUOKW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|