About (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine
(amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine (PubChem CID 87963460) has the molecular formula C14H38N2O5Si2
and a molecular weight of 370.64 g/mol. Its IUPAC name is (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine.
Molecular Properties
| Compound Name | (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine |
| PubChem CID | 87963460 |
| Molecular Formula | C14H38N2O5Si2 |
| Molecular Weight | 370.64 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine |
| SMILES | CCO[Si](N)(CC)OCC.CCO[Si](OCC)(OCC)C(C)N |
| InChI | InChI=1S/C8H21NO3Si.C6H17NO2Si/c1-5-10-13(8(4)9,11-6-2)12-7-3;1-4-8-10(7,6-3)9-5-2/h8H,5-7,9H2,1-4H3;4-7H2,1-3H3 |
| InChIKey | ILXMPLZBVQUYHZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine?
The IUPAC name of (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine (CID 87963460) is (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine.
What is the SMILES notation for (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine?
The canonical SMILES for (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine is CCO[Si](N)(CC)OCC.CCO[Si](OCC)(OCC)C(C)N.
What is the InChIKey of (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine?
The InChIKey is ILXMPLZBVQUYHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H21NO3Si.C6H17NO2Si/c1-5-10-13(8(4)9,11-6-2)12-7-3;1-4-8-10(7,6-3)9-5-2/h8H,5-7,9H2,1-4H3;4-7H2,1-3H3.
What are the key properties of (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine?
(amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine has a molecular weight of 370.64 g/mol, XLogP of 1.90, 12 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (amino-ethoxy-ethylsilyl)oxyethane;1-triethoxysilylethanamine is sourced from PubChem (CID 87963460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).