C23H61N3O9Si3 — CID 88707038
ethane-1,2-diamine;triethoxy(propyl)silane;1-trimethoxysilyl-N-(1-trimethoxysilylpropyl)propan-1-amine (PubChem CID 88707038) has the molecular formula C23H61N3O9Si3 and a molecular weight of 608.01 g/mol. Its IUPAC name is ethane-1,2-diamine;triethoxy(propyl)silane;1-trimethoxysilyl-N-(1-trimethoxysilylpropyl)propan-1-amine.
| Compound Name | ethane-1,2-diamine;triethoxy(propyl)silane;1-trimethoxysilyl-N-(1-trimethoxysilylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 88707038 |
| Molecular Formula | C23H61N3O9Si3 |
| Molecular Weight | 608.01 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | ethane-1,2-diamine;triethoxy(propyl)silane;1-trimethoxysilyl-N-(1-trimethoxysilylpropyl)propan-1-amine |
| SMILES | CCC(NC(CC)[Si](OC)(OC)OC)[Si](OC)(OC)OC.CCC[Si](OCC)(OCC)OCC.NCCN |
| InChI | InChI=1S/C12H31NO6Si2.C9H22O3Si.C2H8N2/c1-9-11(20(14-3,15-4)16-5)13-12(10-2)21(17-6,18-7)19-8;1-5-9-13(10-6-2,11-7-3)12-8-4;3-1-2-4/h11-13H,9-10H2,1-8H3;5-9H2,1-4H3;1-4H2 |
| InChIKey | IAJCTAFQHKGOMQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 147.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.01 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|