C16H14F6N4O2 — CID 87223362
3-hydroxy-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butanal (PubChem CID 87223362) has the molecular formula C16H14F6N4O2 and a molecular weight of 408.30 g/mol. Its IUPAC name is 3-hydroxy-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butanal.
| Compound Name | 3-hydroxy-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butanal |
|---|---|
| PubChem CID | 87223362 |
| Molecular Formula | C16H14F6N4O2 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 3-hydroxy-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butanal |
| SMILES | O=CCC(O)C(c1cc(F)c(F)cc1F)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H14F6N4O2/c17-9-6-11(19)10(18)5-8(9)14(12(28)1-4-27)25-2-3-26-13(7-25)23-24-15(26)16(20,21)22/h4-6,12,14,28H,1-3,7H2 |
| InChIKey | ANLIYTCSBMIRPS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|