C15H14F6N6O — CID 25225023
2-[amino-[(2,4,5-trifluorophenyl)methyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone (PubChem CID 25225023) has the molecular formula C15H14F6N6O and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-[amino-[(2,4,5-trifluorophenyl)methyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone.
| Compound Name | 2-[amino-[(2,4,5-trifluorophenyl)methyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone |
|---|---|
| PubChem CID | 25225023 |
| Molecular Formula | C15H14F6N6O |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[amino-[(2,4,5-trifluorophenyl)methyl]amino]-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]ethanone |
| SMILES | NN(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H14F6N6O/c16-9-4-11(18)10(17)3-8(9)5-26(22)7-13(28)25-1-2-27-12(6-25)23-24-14(27)15(19,20)21/h3-4H,1-2,5-7,22H2 |
| InChIKey | CTCABISKDJAVCH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|