C17H15F6N5O2 — CID 87685826
3-methoxyimino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one (PubChem CID 87685826) has the molecular formula C17H15F6N5O2 and a molecular weight of 435.33 g/mol. Its IUPAC name is 3-methoxyimino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one.
| Compound Name | 3-methoxyimino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 87685826 |
| Molecular Formula | C17H15F6N5O2 |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-methoxyimino-1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-(2,4,5-trifluorophenyl)butan-1-one |
| SMILES | CON=C(CC(=O)N1CCn2c(nnc2C(F)(F)F)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C17H15F6N5O2/c1-30-26-10(4-9-5-12(19)13(20)7-11(9)18)6-15(29)27-2-3-28-14(8-27)24-25-16(28)17(21,22)23/h5,7H,2-4,6,8H2,1H3 |
| InChIKey | JYKXGQKSYSFWRB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|