C18H16F6N5+ — CID 163662021
methylidene-[1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2,4,5-trifluorophenyl)methyl]but-3-enylidene]azanium (PubChem CID 163662021) has the molecular formula C18H16F6N5+ and a molecular weight of 416.35 g/mol. Its IUPAC name is methylidene-[1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2,4,5-trifluorophenyl)methyl]but-3-enylidene]azanium.
| Compound Name | methylidene-[1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2,4,5-trifluorophenyl)methyl]but-3-enylidene]azanium |
|---|---|
| PubChem CID | 163662021 |
| Molecular Formula | C18H16F6N5+ |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | methylidene-[1-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3-[(2,4,5-trifluorophenyl)methyl]but-3-enylidene]azanium |
| SMILES | C=[N+]=C(CC(=C)Cc1cc(F)c(F)cc1F)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C18H16F6N5/c1-10(5-11-7-13(20)14(21)8-12(11)19)6-15(25-2)28-3-4-29-16(9-28)26-27-17(29)18(22,23)24/h7-8H,1-6,9H2/q+1 |
| InChIKey | XELFNQTZKFQEIJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|