C20H20N4O6S2 — CID 87223728
(5E)-5-[[3-[6-(1-methylsulfonylpiperidin-4-yl)oxypyrimidin-4-yl]oxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 87223728) has the molecular formula C20H20N4O6S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is (5E)-5-[[3-[6-(1-methylsulfonylpiperidin-4-yl)oxypyrimidin-4-yl]oxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-[6-(1-methylsulfonylpiperidin-4-yl)oxypyrimidin-4-yl]oxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 87223728 |
| Molecular Formula | C20H20N4O6S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (5E)-5-[[3-[6-(1-methylsulfonylpiperidin-4-yl)oxypyrimidin-4-yl]oxyphenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CS(=O)(=O)N1CCC(Oc2cc(Oc3cccc(/C=C4/SC(=O)NC4=O)c3)ncn2)CC1 |
| InChI | InChI=1S/C20H20N4O6S2/c1-32(27,28)24-7-5-14(6-8-24)29-17-11-18(22-12-21-17)30-15-4-2-3-13(9-15)10-16-19(25)23-20(26)31-16/h2-4,9-12,14H,5-8H2,1H3,(H,23,25,26)/b16-10+ |
| InChIKey | YNFZHNAHXTZMNP-MHWRWJLKSA-N |
| XLogP | 2.40 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|