About 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde
6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde (PubChem CID 87225473) has the molecular formula C13H13N3O
and a molecular weight of 227.27 g/mol. Its IUPAC name is 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde.
Molecular Properties
| Compound Name | 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde |
| PubChem CID | 87225473 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde |
| SMILES | C=O.[N-]=[N+]=C1C=CC=CC1Nc1ccccc1 |
| InChI | InChI=1S/C12H11N3.CH2O/c13-15-12-9-5-4-8-11(12)14-10-6-2-1-3-7-10;1-2/h1-9,11,14H;1H2 |
| InChIKey | BWZMRNIRVONKRB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde?
The IUPAC name of 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde (CID 87225473) is 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde.
What is the SMILES notation for 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde?
The canonical SMILES for 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde is C=O.[N-]=[N+]=C1C=CC=CC1Nc1ccccc1.
What is the InChIKey of 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde?
The InChIKey is BWZMRNIRVONKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3.CH2O/c13-15-12-9-5-4-8-11(12)14-10-6-2-1-3-7-10;1-2/h1-9,11,14H;1H2.
What are the key properties of 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde?
6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde has a molecular weight of 227.27 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazo-N-phenylcyclohexa-2,4-dien-1-amine;formaldehyde is sourced from PubChem (CID 87225473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).