C14H29N7O6 — CID 87226171
(2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 87226171) has the molecular formula C14H29N7O6 and a molecular weight of 391.43 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 87226171 |
| Molecular Formula | C14H29N7O6 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H15N3O4.C6H14N4O2/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12;7-4(5(11)12)2-1-3-10-6(8)9/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t4-,5-;4-/m00/s1 |
| InChIKey | IHEUBGADKKXVAJ-DHYYHALDSA-N |
| XLogP | -3.38 |
| TPSA | 263.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|